C17H16I2N2O4 — CID 13331486
dimethyl 2,2-bis(4-iodoanilino)propanedioate (PubChem CID 13331486) has the molecular formula C17H16I2N2O4 and a molecular weight of 566.13 g/mol. Its IUPAC name is dimethyl 2,2-bis(4-iodoanilino)propanedioate.
| Compound Name | dimethyl 2,2-bis(4-iodoanilino)propanedioate |
|---|---|
| PubChem CID | 13331486 |
| Molecular Formula | C17H16I2N2O4 |
| Molecular Weight | 566.13 g/mol |
| Exact Mass | 565.92 |
| IUPAC Name | dimethyl 2,2-bis(4-iodoanilino)propanedioate |
| SMILES | COC(=O)C(Nc1ccc(I)cc1)(Nc1ccc(I)cc1)C(=O)OC |
| InChI | InChI=1S/C17H16I2N2O4/c1-24-15(22)17(16(23)25-2,20-13-7-3-11(18)4-8-13)21-14-9-5-12(19)6-10-14/h3-10,20-21H,1-2H3 |
| InChIKey | OIZRIVDJEKGEEC-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.13 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|