About N-(4-tert-butylphenyl)-N'-(4-iodophenyl)oxamide
N-(4-tert-butylphenyl)-N'-(4-iodophenyl)oxamide (PubChem CID 108529818) has the molecular formula C18H19IN2O2
and a molecular weight of 422.27 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-N'-(4-iodophenyl)oxamide.
Molecular Properties
| Compound Name | N-(4-tert-butylphenyl)-N'-(4-iodophenyl)oxamide |
| PubChem CID | 108529818 |
| Molecular Formula | C18H19IN2O2 |
| Molecular Weight | 422.27 g/mol |
| Exact Mass | 422.05 |
| IUPAC Name | N-(4-tert-butylphenyl)-N'-(4-iodophenyl)oxamide |
| SMILES | CC(C)(C)c1ccc(NC(=O)C(=O)Nc2ccc(I)cc2)cc1 |
| InChI | InChI=1S/C18H19IN2O2/c1-18(2,3)12-4-8-14(9-5-12)20-16(22)17(23)21-15-10-6-13(19)7-11-15/h4-11H,1-3H3,(H,20,22)(H,21,23) |
| InChIKey | NAEDGMORQTVJHU-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.27 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze N-(4-tert-butylphenyl)-N'-(4-iodophenyl)oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-tert-butylphenyl)-N'-(4-iodophenyl)oxamide?
The IUPAC name of N-(4-tert-butylphenyl)-N'-(4-iodophenyl)oxamide (CID 108529818) is N-(4-tert-butylphenyl)-N'-(4-iodophenyl)oxamide.
What is the SMILES notation for N-(4-tert-butylphenyl)-N'-(4-iodophenyl)oxamide?
The canonical SMILES for N-(4-tert-butylphenyl)-N'-(4-iodophenyl)oxamide is CC(C)(C)c1ccc(NC(=O)C(=O)Nc2ccc(I)cc2)cc1.
What is the InChIKey of N-(4-tert-butylphenyl)-N'-(4-iodophenyl)oxamide?
The InChIKey is NAEDGMORQTVJHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19IN2O2/c1-18(2,3)12-4-8-14(9-5-12)20-16(22)17(23)21-15-10-6-13(19)7-11-15/h4-11H,1-3H3,(H,20,22)(H,21,23).
What are the key properties of N-(4-tert-butylphenyl)-N'-(4-iodophenyl)oxamide?
N-(4-tert-butylphenyl)-N'-(4-iodophenyl)oxamide has a molecular weight of 422.27 g/mol, XLogP of 4.17, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-tert-butylphenyl)-N'-(4-iodophenyl)oxamide is sourced from PubChem (CID 108529818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).