C16H10F6O3 — CID 142415335
methyl 3-fluoro-4-[4-(1,1,2,2,2-pentafluoroethyl)phenoxy]benzoate (PubChem CID 142415335) has the molecular formula C16H10F6O3 and a molecular weight of 364.24 g/mol. Its IUPAC name is methyl 3-fluoro-4-[4-(1,1,2,2,2-pentafluoroethyl)phenoxy]benzoate.
| Compound Name | methyl 3-fluoro-4-[4-(1,1,2,2,2-pentafluoroethyl)phenoxy]benzoate |
|---|---|
| PubChem CID | 142415335 |
| Molecular Formula | C16H10F6O3 |
| Molecular Weight | 364.24 g/mol |
| Exact Mass | 364.05 |
| IUPAC Name | methyl 3-fluoro-4-[4-(1,1,2,2,2-pentafluoroethyl)phenoxy]benzoate |
| SMILES | COC(=O)c1ccc(Oc2ccc(C(F)(F)C(F)(F)F)cc2)c(F)c1 |
| InChI | InChI=1S/C16H10F6O3/c1-24-14(23)9-2-7-13(12(17)8-9)25-11-5-3-10(4-6-11)15(18,19)16(20,21)22/h2-8H,1H3 |
| InChIKey | YLFPZPQTNCUYGL-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.24 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|