C17H16F3NO2 — CID 162134350
4-[4-(1,1-difluoroethyl)phenoxy]-3-fluoro-N,N-dimethylbenzamide (PubChem CID 162134350) has the molecular formula C17H16F3NO2 and a molecular weight of 323.31 g/mol. Its IUPAC name is 4-[4-(1,1-difluoroethyl)phenoxy]-3-fluoro-N,N-dimethylbenzamide.
| Compound Name | 4-[4-(1,1-difluoroethyl)phenoxy]-3-fluoro-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 162134350 |
| Molecular Formula | C17H16F3NO2 |
| Molecular Weight | 323.31 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | 4-[4-(1,1-difluoroethyl)phenoxy]-3-fluoro-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccc(Oc2ccc(C(C)(F)F)cc2)c(F)c1 |
| InChI | InChI=1S/C17H16F3NO2/c1-17(19,20)12-5-7-13(8-6-12)23-15-9-4-11(10-14(15)18)16(22)21(2)3/h4-10H,1-3H3 |
| InChIKey | ZJBMZVOVQXTXAF-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.31 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |