C17H12F7NO2 — CID 158189564
3-fluoro-4-[4-(1,1,2,2,3,3-hexafluorobutyl)phenoxy]benzamide (PubChem CID 158189564) has the molecular formula C17H12F7NO2 and a molecular weight of 395.27 g/mol. Its IUPAC name is 3-fluoro-4-[4-(1,1,2,2,3,3-hexafluorobutyl)phenoxy]benzamide.
| Compound Name | 3-fluoro-4-[4-(1,1,2,2,3,3-hexafluorobutyl)phenoxy]benzamide |
|---|---|
| PubChem CID | 158189564 |
| Molecular Formula | C17H12F7NO2 |
| Molecular Weight | 395.27 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | 3-fluoro-4-[4-(1,1,2,2,3,3-hexafluorobutyl)phenoxy]benzamide |
| SMILES | CC(F)(F)C(F)(F)C(F)(F)c1ccc(Oc2ccc(C(N)=O)cc2F)cc1 |
| InChI | InChI=1S/C17H12F7NO2/c1-15(19,20)17(23,24)16(21,22)10-3-5-11(6-4-10)27-13-7-2-9(14(25)26)8-12(13)18/h2-8H,1H3,(H2,25,26) |
| InChIKey | FZOPLXBDJAJETO-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.27 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|