C17H13F6NO2 — CID 159342881
4-[4-(1,1,2,2,3,3-hexafluorobutyl)phenoxy]benzamide (PubChem CID 159342881) has the molecular formula C17H13F6NO2 and a molecular weight of 377.28 g/mol. Its IUPAC name is 4-[4-(1,1,2,2,3,3-hexafluorobutyl)phenoxy]benzamide.
| Compound Name | 4-[4-(1,1,2,2,3,3-hexafluorobutyl)phenoxy]benzamide |
|---|---|
| PubChem CID | 159342881 |
| Molecular Formula | C17H13F6NO2 |
| Molecular Weight | 377.28 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | 4-[4-(1,1,2,2,3,3-hexafluorobutyl)phenoxy]benzamide |
| SMILES | CC(F)(F)C(F)(F)C(F)(F)c1ccc(Oc2ccc(C(N)=O)cc2)cc1 |
| InChI | InChI=1S/C17H13F6NO2/c1-15(18,19)17(22,23)16(20,21)11-4-8-13(9-5-11)26-12-6-2-10(3-7-12)14(24)25/h2-9H,1H3,(H2,24,25) |
| InChIKey | LGIUKLCLZITMBX-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.28 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|