C17H13F6NO3 — CID 147220326
methyl 6-[4-(1,1,2,2,3,3-hexafluorobutyl)phenoxy]pyridine-3-carboxylate (PubChem CID 147220326) has the molecular formula C17H13F6NO3 and a molecular weight of 393.28 g/mol. Its IUPAC name is methyl 6-[4-(1,1,2,2,3,3-hexafluorobutyl)phenoxy]pyridine-3-carboxylate.
| Compound Name | methyl 6-[4-(1,1,2,2,3,3-hexafluorobutyl)phenoxy]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 147220326 |
| Molecular Formula | C17H13F6NO3 |
| Molecular Weight | 393.28 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | methyl 6-[4-(1,1,2,2,3,3-hexafluorobutyl)phenoxy]pyridine-3-carboxylate |
| SMILES | COC(=O)c1ccc(Oc2ccc(C(F)(F)C(F)(F)C(C)(F)F)cc2)nc1 |
| InChI | InChI=1S/C17H13F6NO3/c1-15(18,19)17(22,23)16(20,21)11-4-6-12(7-5-11)27-13-8-3-10(9-24-13)14(25)26-2/h3-9H,1-2H3 |
| InChIKey | CGYAGYPQVZRJME-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.28 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|