C16H11F7N2O2 — CID 146305828
6-[4-(1,1,2,2,3,3,3-heptafluoropropyl)phenoxy]-N-methylpyridine-3-carboxamide (PubChem CID 146305828) has the molecular formula C16H11F7N2O2 and a molecular weight of 396.26 g/mol. Its IUPAC name is 6-[4-(1,1,2,2,3,3,3-heptafluoropropyl)phenoxy]-N-methylpyridine-3-carboxamide.
| Compound Name | 6-[4-(1,1,2,2,3,3,3-heptafluoropropyl)phenoxy]-N-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 146305828 |
| Molecular Formula | C16H11F7N2O2 |
| Molecular Weight | 396.26 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | 6-[4-(1,1,2,2,3,3,3-heptafluoropropyl)phenoxy]-N-methylpyridine-3-carboxamide |
| SMILES | CNC(=O)c1ccc(Oc2ccc(C(F)(F)C(F)(F)C(F)(F)F)cc2)nc1 |
| InChI | InChI=1S/C16H11F7N2O2/c1-24-13(26)9-2-7-12(25-8-9)27-11-5-3-10(4-6-11)14(17,18)15(19,20)16(21,22)23/h2-8H,1H3,(H,24,26) |
| InChIKey | LLKUNSUYWGRGHC-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.26 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|