C13H9F3N2O3 — CID 135313676
N-hydroxy-6-[4-(trifluoromethyl)phenoxy]pyridine-3-carboxamide (PubChem CID 135313676) has the molecular formula C13H9F3N2O3 and a molecular weight of 298.22 g/mol. Its IUPAC name is N-hydroxy-6-[4-(trifluoromethyl)phenoxy]pyridine-3-carboxamide.
| Compound Name | N-hydroxy-6-[4-(trifluoromethyl)phenoxy]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 135313676 |
| Molecular Formula | C13H9F3N2O3 |
| Molecular Weight | 298.22 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | N-hydroxy-6-[4-(trifluoromethyl)phenoxy]pyridine-3-carboxamide |
| SMILES | O=C(NO)c1ccc(Oc2ccc(C(F)(F)F)cc2)nc1 |
| InChI | InChI=1S/C13H9F3N2O3/c14-13(15,16)9-2-4-10(5-3-9)21-11-6-1-8(7-17-11)12(19)18-20/h1-7,20H,(H,18,19) |
| InChIKey | BUHXVTMNXPJKSG-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.22 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|