C22H20F3N3O2 — CID 68752063
6-[4-[2-[[4-(trifluoromethyl)phenyl]methylamino]ethyl]phenoxy]pyridine-3-carboxamide (PubChem CID 68752063) has the molecular formula C22H20F3N3O2 and a molecular weight of 415.42 g/mol. Its IUPAC name is 6-[4-[2-[[4-(trifluoromethyl)phenyl]methylamino]ethyl]phenoxy]pyridine-3-carboxamide.
| Compound Name | 6-[4-[2-[[4-(trifluoromethyl)phenyl]methylamino]ethyl]phenoxy]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 68752063 |
| Molecular Formula | C22H20F3N3O2 |
| Molecular Weight | 415.42 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | 6-[4-[2-[[4-(trifluoromethyl)phenyl]methylamino]ethyl]phenoxy]pyridine-3-carboxamide |
| SMILES | NC(=O)c1ccc(Oc2ccc(CCNCc3ccc(C(F)(F)F)cc3)cc2)nc1 |
| InChI | InChI=1S/C22H20F3N3O2/c23-22(24,25)18-6-1-16(2-7-18)13-27-12-11-15-3-8-19(9-4-15)30-20-10-5-17(14-28-20)21(26)29/h1-10,14,27H,11-13H2,(H2,26,29) |
| InChIKey | STXJCAVIYLPLJC-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.42 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|