C23H16F3N2O4- — CID 151676144
3-[4-[[5-[[4-(trifluoromethyl)phenyl]carbamoyl]-2-pyridinyl]oxy]phenyl]but-2-enoate (PubChem CID 151676144) has the molecular formula C23H16F3N2O4- and a molecular weight of 441.39 g/mol. Its IUPAC name is 3-[4-[[5-[[4-(trifluoromethyl)phenyl]carbamoyl]-2-pyridinyl]oxy]phenyl]but-2-enoate.
| Compound Name | 3-[4-[[5-[[4-(trifluoromethyl)phenyl]carbamoyl]-2-pyridinyl]oxy]phenyl]but-2-enoate |
|---|---|
| PubChem CID | 151676144 |
| Molecular Formula | C23H16F3N2O4- |
| Molecular Weight | 441.39 g/mol |
| Exact Mass | 441.11 |
| IUPAC Name | 3-[4-[[5-[[4-(trifluoromethyl)phenyl]carbamoyl]-2-pyridinyl]oxy]phenyl]but-2-enoate |
| SMILES | CC(=CC(=O)[O-])c1ccc(Oc2ccc(C(=O)Nc3ccc(C(F)(F)F)cc3)cn2)cc1 |
| InChI | InChI=1S/C23H17F3N2O4/c1-14(12-21(29)30)15-2-9-19(10-3-15)32-20-11-4-16(13-27-20)22(31)28-18-7-5-17(6-8-18)23(24,25)26/h2-13H,1H3,(H,28,31)(H,29,30)/p-1 |
| InChIKey | QZODKHTZNHHDTQ-UHFFFAOYSA-M |
| XLogP | 4.30 |
| TPSA | 91.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.39 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|