C18H15F6NO3 — CID 161046198
ethyl 6-[4-(1,1,2,2,3,3-hexafluorobutyl)phenoxy]pyridine-3-carboxylate (PubChem CID 161046198) has the molecular formula C18H15F6NO3 and a molecular weight of 407.31 g/mol. Its IUPAC name is ethyl 6-[4-(1,1,2,2,3,3-hexafluorobutyl)phenoxy]pyridine-3-carboxylate.
| Compound Name | ethyl 6-[4-(1,1,2,2,3,3-hexafluorobutyl)phenoxy]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 161046198 |
| Molecular Formula | C18H15F6NO3 |
| Molecular Weight | 407.31 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | ethyl 6-[4-(1,1,2,2,3,3-hexafluorobutyl)phenoxy]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1ccc(Oc2ccc(C(F)(F)C(F)(F)C(C)(F)F)cc2)nc1 |
| InChI | InChI=1S/C18H15F6NO3/c1-3-27-15(26)11-4-9-14(25-10-11)28-13-7-5-12(6-8-13)17(21,22)18(23,24)16(2,19)20/h4-10H,3H2,1-2H3 |
| InChIKey | UBNKQMXEUPYCOO-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.31 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|