ethyl 6-[4-(1,3,4-oxadiazol-2-yl)phenoxy]pyridine-3-carboxylate

C16H13N3O4 — CID 31535631

IUPACethyl 6-[4-(1,3,4-oxadiazol-2-yl)phenoxy]pyridine-3-carboxylate
SMILESCCOC(=O)c1ccc(Oc2ccc(-c3nnco3)cc2)nc1
InChIInChI=1S/C16H13N3O4/c1-2-21-16(20)12-5-8-14(17-9-12)23-13-6-3-11(4-7-13)15-19-18-10-22-15/h3-10H,2H2,1H3
InChIKeyALZPFMZKNRMQDS-UHFFFAOYSA-N
MW311.30 g/mol
LogP3.10
Rot. Bonds5

About ethyl 6-[4-(1,3,4-oxadiazol-2-yl)phenoxy]pyridine-3-carboxylate

ethyl 6-[4-(1,3,4-oxadiazol-2-yl)phenoxy]pyridine-3-carboxylate (PubChem CID 31535631) has the molecular formula C16H13N3O4 and a molecular weight of 311.30 g/mol. Its IUPAC name is ethyl 6-[4-(1,3,4-oxadiazol-2-yl)phenoxy]pyridine-3-carboxylate.

Molecular Properties

Compound Nameethyl 6-[4-(1,3,4-oxadiazol-2-yl)phenoxy]pyridine-3-carboxylate
PubChem CID31535631
Molecular FormulaC16H13N3O4
Molecular Weight311.30 g/mol
Exact Mass311.09
IUPAC Nameethyl 6-[4-(1,3,4-oxadiazol-2-yl)phenoxy]pyridine-3-carboxylate
SMILESCCOC(=O)c1ccc(Oc2ccc(-c3nnco3)cc2)nc1
InChIInChI=1S/C16H13N3O4/c1-2-21-16(20)12-5-8-14(17-9-12)23-13-6-3-11(4-7-13)15-19-18-10-22-15/h3-10H,2H2,1H3
InChIKeyALZPFMZKNRMQDS-UHFFFAOYSA-N
XLogP3.10
TPSA87.34 Ų
H-Bond Donors
H-Bond Acceptors7
Rotatable Bonds5
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500311.30
LogP ≤ 53.10
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 107

Analyze ethyl 6-[4-(1,3,4-oxadiazol-2-yl)phenoxy]pyridine-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 6-[4-(1,3,4-oxadiazol-2-yl)phenoxy]pyridine-3-carboxylate?
The IUPAC name of ethyl 6-[4-(1,3,4-oxadiazol-2-yl)phenoxy]pyridine-3-carboxylate (CID 31535631) is ethyl 6-[4-(1,3,4-oxadiazol-2-yl)phenoxy]pyridine-3-carboxylate.
What is the SMILES notation for ethyl 6-[4-(1,3,4-oxadiazol-2-yl)phenoxy]pyridine-3-carboxylate?
The canonical SMILES for ethyl 6-[4-(1,3,4-oxadiazol-2-yl)phenoxy]pyridine-3-carboxylate is CCOC(=O)c1ccc(Oc2ccc(-c3nnco3)cc2)nc1.
What is the InChIKey of ethyl 6-[4-(1,3,4-oxadiazol-2-yl)phenoxy]pyridine-3-carboxylate?
The InChIKey is ALZPFMZKNRMQDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13N3O4/c1-2-21-16(20)12-5-8-14(17-9-12)23-13-6-3-11(4-7-13)15-19-18-10-22-15/h3-10H,2H2,1H3.
What are the key properties of ethyl 6-[4-(1,3,4-oxadiazol-2-yl)phenoxy]pyridine-3-carboxylate?
ethyl 6-[4-(1,3,4-oxadiazol-2-yl)phenoxy]pyridine-3-carboxylate has a molecular weight of 311.30 g/mol, XLogP of 3.10, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 6-[4-(1,3,4-oxadiazol-2-yl)phenoxy]pyridine-3-carboxylate is sourced from PubChem (CID 31535631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).