C18H14F7NO2 — CID 158413383
1-[5-fluoro-6-[4-(1,1,2,2,3,3-hexafluorobutyl)phenoxy]-3-pyridinyl]propan-1-one (PubChem CID 158413383) has the molecular formula C18H14F7NO2 and a molecular weight of 409.30 g/mol. Its IUPAC name is 1-[5-fluoro-6-[4-(1,1,2,2,3,3-hexafluorobutyl)phenoxy]-3-pyridinyl]propan-1-one.
| Compound Name | 1-[5-fluoro-6-[4-(1,1,2,2,3,3-hexafluorobutyl)phenoxy]-3-pyridinyl]propan-1-one |
|---|---|
| PubChem CID | 158413383 |
| Molecular Formula | C18H14F7NO2 |
| Molecular Weight | 409.30 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | 1-[5-fluoro-6-[4-(1,1,2,2,3,3-hexafluorobutyl)phenoxy]-3-pyridinyl]propan-1-one |
| SMILES | CCC(=O)c1cnc(Oc2ccc(C(F)(F)C(F)(F)C(C)(F)F)cc2)c(F)c1 |
| InChI | InChI=1S/C18H14F7NO2/c1-3-14(27)10-8-13(19)15(26-9-10)28-12-6-4-11(5-7-12)17(22,23)18(24,25)16(2,20)21/h4-9H,3H2,1-2H3 |
| InChIKey | GZOWEGYUGKRDFG-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.30 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|