C14H9F4NO3 — CID 146305884
methyl 5-fluoro-6-[4-(trifluoromethyl)phenoxy]pyridine-3-carboxylate (PubChem CID 146305884) has the molecular formula C14H9F4NO3 and a molecular weight of 315.22 g/mol. Its IUPAC name is methyl 5-fluoro-6-[4-(trifluoromethyl)phenoxy]pyridine-3-carboxylate.
| Compound Name | methyl 5-fluoro-6-[4-(trifluoromethyl)phenoxy]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 146305884 |
| Molecular Formula | C14H9F4NO3 |
| Molecular Weight | 315.22 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | methyl 5-fluoro-6-[4-(trifluoromethyl)phenoxy]pyridine-3-carboxylate |
| SMILES | COC(=O)c1cnc(Oc2ccc(C(F)(F)F)cc2)c(F)c1 |
| InChI | InChI=1S/C14H9F4NO3/c1-21-13(20)8-6-11(15)12(19-7-8)22-10-4-2-9(3-5-10)14(16,17)18/h2-7H,1H3 |
| InChIKey | IVIRFELGBBTGRT-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.22 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |