C16H16BF3N2O5 — CID 170701106
[5-[[(2R)-1-hydroxypropan-2-yl]carbamoyl]-2-[4-(trifluoromethyl)phenoxy]-3-pyridinyl]boronic acid (PubChem CID 170701106) has the molecular formula C16H16BF3N2O5 and a molecular weight of 384.12 g/mol. Its IUPAC name is [5-[[(2R)-1-hydroxypropan-2-yl]carbamoyl]-2-[4-(trifluoromethyl)phenoxy]-3-pyridinyl]boronic acid.
| Compound Name | [5-[[(2R)-1-hydroxypropan-2-yl]carbamoyl]-2-[4-(trifluoromethyl)phenoxy]-3-pyridinyl]boronic acid |
|---|---|
| PubChem CID | 170701106 |
| Molecular Formula | C16H16BF3N2O5 |
| Molecular Weight | 384.12 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | [5-[[(2R)-1-hydroxypropan-2-yl]carbamoyl]-2-[4-(trifluoromethyl)phenoxy]-3-pyridinyl]boronic acid |
| SMILES | C[C@H](CO)NC(=O)c1cnc(Oc2ccc(C(F)(F)F)cc2)c(B(O)O)c1 |
| InChI | InChI=1S/C16H16BF3N2O5/c1-9(8-23)22-14(24)10-6-13(17(25)26)15(21-7-10)27-12-4-2-11(3-5-12)16(18,19)20/h2-7,9,23,25-26H,8H2,1H3,(H,22,24)/t9-/m1/s1 |
| InChIKey | KBDBEODTBSBBAC-SECBINFHSA-N |
| XLogP | 0.68 |
| TPSA | 111.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.12 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|