C18H13F6NO3 — CID 146325743
methyl 5-fluoro-6-[4-[1-(1,1,2,2,2-pentafluoroethyl)cyclopropyl]phenoxy]pyridine-3-carboxylate (PubChem CID 146325743) has the molecular formula C18H13F6NO3 and a molecular weight of 405.29 g/mol. Its IUPAC name is methyl 5-fluoro-6-[4-[1-(1,1,2,2,2-pentafluoroethyl)cyclopropyl]phenoxy]pyridine-3-carboxylate.
| Compound Name | methyl 5-fluoro-6-[4-[1-(1,1,2,2,2-pentafluoroethyl)cyclopropyl]phenoxy]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 146325743 |
| Molecular Formula | C18H13F6NO3 |
| Molecular Weight | 405.29 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | methyl 5-fluoro-6-[4-[1-(1,1,2,2,2-pentafluoroethyl)cyclopropyl]phenoxy]pyridine-3-carboxylate |
| SMILES | COC(=O)c1cnc(Oc2ccc(C3(C(F)(F)C(F)(F)F)CC3)cc2)c(F)c1 |
| InChI | InChI=1S/C18H13F6NO3/c1-27-15(26)10-8-13(19)14(25-9-10)28-12-4-2-11(3-5-12)16(6-7-16)17(20,21)18(22,23)24/h2-5,8-9H,6-7H2,1H3 |
| InChIKey | INYSDMJKDKUVFI-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.29 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|