C20H15F3N2O3 — CID 170701258
methyl 5-(4-methyl-2-pyridinyl)-6-[4-(trifluoromethyl)phenoxy]pyridine-3-carboxylate (PubChem CID 170701258) has the molecular formula C20H15F3N2O3 and a molecular weight of 388.35 g/mol. Its IUPAC name is methyl 5-(4-methyl-2-pyridinyl)-6-[4-(trifluoromethyl)phenoxy]pyridine-3-carboxylate.
| Compound Name | methyl 5-(4-methyl-2-pyridinyl)-6-[4-(trifluoromethyl)phenoxy]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 170701258 |
| Molecular Formula | C20H15F3N2O3 |
| Molecular Weight | 388.35 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | methyl 5-(4-methyl-2-pyridinyl)-6-[4-(trifluoromethyl)phenoxy]pyridine-3-carboxylate |
| SMILES | COC(=O)c1cnc(Oc2ccc(C(F)(F)F)cc2)c(-c2cc(C)ccn2)c1 |
| InChI | InChI=1S/C20H15F3N2O3/c1-12-7-8-24-17(9-12)16-10-13(19(26)27-2)11-25-18(16)28-15-5-3-14(4-6-15)20(21,22)23/h3-11H,1-2H3 |
| InChIKey | GLZKEUVVLFDXSR-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.35 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |