C17H12F3N3O3 — CID 170701180
5-(1-methylpyrazol-3-yl)-6-[4-(trifluoromethyl)phenoxy]pyridine-3-carboxylic acid (PubChem CID 170701180) has the molecular formula C17H12F3N3O3 and a molecular weight of 363.30 g/mol. Its IUPAC name is 5-(1-methylpyrazol-3-yl)-6-[4-(trifluoromethyl)phenoxy]pyridine-3-carboxylic acid.
| Compound Name | 5-(1-methylpyrazol-3-yl)-6-[4-(trifluoromethyl)phenoxy]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 170701180 |
| Molecular Formula | C17H12F3N3O3 |
| Molecular Weight | 363.30 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | 5-(1-methylpyrazol-3-yl)-6-[4-(trifluoromethyl)phenoxy]pyridine-3-carboxylic acid |
| SMILES | Cn1ccc(-c2cc(C(=O)O)cnc2Oc2ccc(C(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C17H12F3N3O3/c1-23-7-6-14(22-23)13-8-10(16(24)25)9-21-15(13)26-12-4-2-11(3-5-12)17(18,19)20/h2-9H,1H3,(H,24,25) |
| InChIKey | OUUKNQGFIGVASV-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.30 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |