C19H14F6O3 — CID 142414802
methyl 4-[2-fluoro-4-[1-(1,1,2,2,2-pentafluoroethyl)cyclopropyl]phenoxy]benzoate (PubChem CID 142414802) has the molecular formula C19H14F6O3 and a molecular weight of 404.31 g/mol. Its IUPAC name is methyl 4-[2-fluoro-4-[1-(1,1,2,2,2-pentafluoroethyl)cyclopropyl]phenoxy]benzoate.
| Compound Name | methyl 4-[2-fluoro-4-[1-(1,1,2,2,2-pentafluoroethyl)cyclopropyl]phenoxy]benzoate |
|---|---|
| PubChem CID | 142414802 |
| Molecular Formula | C19H14F6O3 |
| Molecular Weight | 404.31 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | methyl 4-[2-fluoro-4-[1-(1,1,2,2,2-pentafluoroethyl)cyclopropyl]phenoxy]benzoate |
| SMILES | COC(=O)c1ccc(Oc2ccc(C3(C(F)(F)C(F)(F)F)CC3)cc2F)cc1 |
| InChI | InChI=1S/C19H14F6O3/c1-27-16(26)11-2-5-13(6-3-11)28-15-7-4-12(10-14(15)20)17(8-9-17)18(21,22)19(23,24)25/h2-7,10H,8-9H2,1H3 |
| InChIKey | SMZLRGIKSWZSJO-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.31 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|