C19H17F6NO2 — CID 161222669
4-[4-(1,1,2,2,3,3-hexafluorobutyl)phenoxy]-N,N-dimethylbenzamide (PubChem CID 161222669) has the molecular formula C19H17F6NO2 and a molecular weight of 405.34 g/mol. Its IUPAC name is 4-[4-(1,1,2,2,3,3-hexafluorobutyl)phenoxy]-N,N-dimethylbenzamide.
| Compound Name | 4-[4-(1,1,2,2,3,3-hexafluorobutyl)phenoxy]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 161222669 |
| Molecular Formula | C19H17F6NO2 |
| Molecular Weight | 405.34 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | 4-[4-(1,1,2,2,3,3-hexafluorobutyl)phenoxy]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccc(Oc2ccc(C(F)(F)C(F)(F)C(C)(F)F)cc2)cc1 |
| InChI | InChI=1S/C19H17F6NO2/c1-17(20,21)19(24,25)18(22,23)13-6-10-15(11-7-13)28-14-8-4-12(5-9-14)16(27)26(2)3/h4-11H,1-3H3 |
| InChIKey | UXSMUZIEJJQYBQ-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.34 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|