C18H18F3NO2 — CID 158611008
N,N-dimethyl-4-[4-(1,1,1-trifluoropropan-2-yl)phenoxy]benzamide (PubChem CID 158611008) has the molecular formula C18H18F3NO2 and a molecular weight of 337.34 g/mol. Its IUPAC name is N,N-dimethyl-4-[4-(1,1,1-trifluoropropan-2-yl)phenoxy]benzamide.
| Compound Name | N,N-dimethyl-4-[4-(1,1,1-trifluoropropan-2-yl)phenoxy]benzamide |
|---|---|
| PubChem CID | 158611008 |
| Molecular Formula | C18H18F3NO2 |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | N,N-dimethyl-4-[4-(1,1,1-trifluoropropan-2-yl)phenoxy]benzamide |
| SMILES | CC(c1ccc(Oc2ccc(C(=O)N(C)C)cc2)cc1)C(F)(F)F |
| InChI | InChI=1S/C18H18F3NO2/c1-12(18(19,20)21)13-4-8-15(9-5-13)24-16-10-6-14(7-11-16)17(23)22(2)3/h4-12H,1-3H3 |
| InChIKey | HWVLUAVWBAXRRR-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |