C16H12F4O3 — CID 160556906
3-fluoro-4-[4-(1,1,1-trifluoropropan-2-yl)phenoxy]benzoic acid (PubChem CID 160556906) has the molecular formula C16H12F4O3 and a molecular weight of 328.26 g/mol. Its IUPAC name is 3-fluoro-4-[4-(1,1,1-trifluoropropan-2-yl)phenoxy]benzoic acid.
| Compound Name | 3-fluoro-4-[4-(1,1,1-trifluoropropan-2-yl)phenoxy]benzoic acid |
|---|---|
| PubChem CID | 160556906 |
| Molecular Formula | C16H12F4O3 |
| Molecular Weight | 328.26 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | 3-fluoro-4-[4-(1,1,1-trifluoropropan-2-yl)phenoxy]benzoic acid |
| SMILES | CC(c1ccc(Oc2ccc(C(=O)O)cc2F)cc1)C(F)(F)F |
| InChI | InChI=1S/C16H12F4O3/c1-9(16(18,19)20)10-2-5-12(6-3-10)23-14-7-4-11(15(21)22)8-13(14)17/h2-9H,1H3,(H,21,22) |
| InChIKey | QYUOFKALXNLILR-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.26 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |