C16H11F6NO2 — CID 142414901
4-[4-(1,1,1,3,3,3-hexafluoropropan-2-yl)phenoxy]benzamide (PubChem CID 142414901) has the molecular formula C16H11F6NO2 and a molecular weight of 363.26 g/mol. Its IUPAC name is 4-[4-(1,1,1,3,3,3-hexafluoropropan-2-yl)phenoxy]benzamide.
| Compound Name | 4-[4-(1,1,1,3,3,3-hexafluoropropan-2-yl)phenoxy]benzamide |
|---|---|
| PubChem CID | 142414901 |
| Molecular Formula | C16H11F6NO2 |
| Molecular Weight | 363.26 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | 4-[4-(1,1,1,3,3,3-hexafluoropropan-2-yl)phenoxy]benzamide |
| SMILES | NC(=O)c1ccc(Oc2ccc(C(C(F)(F)F)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C16H11F6NO2/c17-15(18,19)13(16(20,21)22)9-1-5-11(6-2-9)25-12-7-3-10(4-8-12)14(23)24/h1-8,13H,(H2,23,24) |
| InChIKey | CXNJHLPKPVWAMI-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.26 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |