About (E)-but-2-enedioic acid;4-phenoxybenzamide
(E)-but-2-enedioic acid;4-phenoxybenzamide (PubChem CID 68593915) has the molecular formula C17H15NO6
and a molecular weight of 329.31 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;4-phenoxybenzamide.
Molecular Properties
| Compound Name | (E)-but-2-enedioic acid;4-phenoxybenzamide |
| PubChem CID | 68593915 |
| Molecular Formula | C17H15NO6 |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | (E)-but-2-enedioic acid;4-phenoxybenzamide |
| SMILES | NC(=O)c1ccc(Oc2ccccc2)cc1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C13H11NO2.C4H4O4/c14-13(15)10-6-8-12(9-7-10)16-11-4-2-1-3-5-11;5-3(6)1-2-4(7)8/h1-9H,(H2,14,15);1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | JAVKGLJSGHNIIB-WLHGVMLRSA-N |
| XLogP | 2.29 |
| TPSA | 126.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-but-2-enedioic acid;4-phenoxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-but-2-enedioic acid;4-phenoxybenzamide?
The IUPAC name of (E)-but-2-enedioic acid;4-phenoxybenzamide (CID 68593915) is (E)-but-2-enedioic acid;4-phenoxybenzamide.
What is the SMILES notation for (E)-but-2-enedioic acid;4-phenoxybenzamide?
The canonical SMILES for (E)-but-2-enedioic acid;4-phenoxybenzamide is NC(=O)c1ccc(Oc2ccccc2)cc1.O=C(O)/C=C/C(=O)O.
What is the InChIKey of (E)-but-2-enedioic acid;4-phenoxybenzamide?
The InChIKey is JAVKGLJSGHNIIB-WLHGVMLRSA-N. The full InChI is InChI=1S/C13H11NO2.C4H4O4/c14-13(15)10-6-8-12(9-7-10)16-11-4-2-1-3-5-11;5-3(6)1-2-4(7)8/h1-9H,(H2,14,15);1-2H,(H,5,6)(H,7,8)/b;2-1+.
What are the key properties of (E)-but-2-enedioic acid;4-phenoxybenzamide?
(E)-but-2-enedioic acid;4-phenoxybenzamide has a molecular weight of 329.31 g/mol, XLogP of 2.29, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-but-2-enedioic acid;4-phenoxybenzamide is sourced from PubChem (CID 68593915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).