C19H22FNO2 — CID 146306005
4-(4-tert-butylphenoxy)-3-fluoro-N,N-dimethylbenzamide (PubChem CID 146306005) has the molecular formula C19H22FNO2 and a molecular weight of 315.39 g/mol. Its IUPAC name is 4-(4-tert-butylphenoxy)-3-fluoro-N,N-dimethylbenzamide.
| Compound Name | 4-(4-tert-butylphenoxy)-3-fluoro-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 146306005 |
| Molecular Formula | C19H22FNO2 |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 4-(4-tert-butylphenoxy)-3-fluoro-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccc(Oc2ccc(C(C)(C)C)cc2)c(F)c1 |
| InChI | InChI=1S/C19H22FNO2/c1-19(2,3)14-7-9-15(10-8-14)23-17-11-6-13(12-16(17)20)18(22)21(4)5/h6-12H,1-5H3 |
| InChIKey | IZMVUUUTPLXBNG-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |