C22H26FNO2 — CID 142415067
4-(4-cycloheptylphenoxy)-3-fluoro-N,N-dimethylbenzamide (PubChem CID 142415067) has the molecular formula C22H26FNO2 and a molecular weight of 355.45 g/mol. Its IUPAC name is 4-(4-cycloheptylphenoxy)-3-fluoro-N,N-dimethylbenzamide.
| Compound Name | 4-(4-cycloheptylphenoxy)-3-fluoro-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 142415067 |
| Molecular Formula | C22H26FNO2 |
| Molecular Weight | 355.45 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | 4-(4-cycloheptylphenoxy)-3-fluoro-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccc(Oc2ccc(C3CCCCCC3)cc2)c(F)c1 |
| InChI | InChI=1S/C22H26FNO2/c1-24(2)22(25)18-11-14-21(20(23)15-18)26-19-12-9-17(10-13-19)16-7-5-3-4-6-8-16/h9-16H,3-8H2,1-2H3 |
| InChIKey | RDYFSHBYEMGCJJ-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.45 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |