About [3-fluoro-4-(trifluoromethoxy)phenyl] 4-cyclohexylbenzoate
[3-fluoro-4-(trifluoromethoxy)phenyl] 4-cyclohexylbenzoate (PubChem CID 126565049) has the molecular formula C20H18F4O3
and a molecular weight of 382.35 g/mol. Its IUPAC name is [3-fluoro-4-(trifluoromethoxy)phenyl] 4-cyclohexylbenzoate.
Molecular Properties
| Compound Name | [3-fluoro-4-(trifluoromethoxy)phenyl] 4-cyclohexylbenzoate |
| PubChem CID | 126565049 |
| Molecular Formula | C20H18F4O3 |
| Molecular Weight | 382.35 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | [3-fluoro-4-(trifluoromethoxy)phenyl] 4-cyclohexylbenzoate |
| SMILES | O=C(Oc1ccc(OC(F)(F)F)c(F)c1)c1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C20H18F4O3/c21-17-12-16(10-11-18(17)27-20(22,23)24)26-19(25)15-8-6-14(7-9-15)13-4-2-1-3-5-13/h6-13H,1-5H2 |
| InChIKey | UAUORPJCIUALSC-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 382.35 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [3-fluoro-4-(trifluoromethoxy)phenyl] 4-cyclohexylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-fluoro-4-(trifluoromethoxy)phenyl] 4-cyclohexylbenzoate?
The IUPAC name of [3-fluoro-4-(trifluoromethoxy)phenyl] 4-cyclohexylbenzoate (CID 126565049) is [3-fluoro-4-(trifluoromethoxy)phenyl] 4-cyclohexylbenzoate.
What is the SMILES notation for [3-fluoro-4-(trifluoromethoxy)phenyl] 4-cyclohexylbenzoate?
The canonical SMILES for [3-fluoro-4-(trifluoromethoxy)phenyl] 4-cyclohexylbenzoate is O=C(Oc1ccc(OC(F)(F)F)c(F)c1)c1ccc(C2CCCCC2)cc1.
What is the InChIKey of [3-fluoro-4-(trifluoromethoxy)phenyl] 4-cyclohexylbenzoate?
The InChIKey is UAUORPJCIUALSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18F4O3/c21-17-12-16(10-11-18(17)27-20(22,23)24)26-19(25)15-8-6-14(7-9-15)13-4-2-1-3-5-13/h6-13H,1-5H2.
What are the key properties of [3-fluoro-4-(trifluoromethoxy)phenyl] 4-cyclohexylbenzoate?
[3-fluoro-4-(trifluoromethoxy)phenyl] 4-cyclohexylbenzoate has a molecular weight of 382.35 g/mol, XLogP of 5.99, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-fluoro-4-(trifluoromethoxy)phenyl] 4-cyclohexylbenzoate is sourced from PubChem (CID 126565049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).