About [4-(difluoromethoxy)-3-fluorophenyl] 4-(4-methylcyclohexyl)benzoate;molecular hydrogen
[4-(difluoromethoxy)-3-fluorophenyl] 4-(4-methylcyclohexyl)benzoate;molecular hydrogen (PubChem CID 157098918) has the molecular formula C21H23F3O3
and a molecular weight of 380.41 g/mol. Its IUPAC name is [4-(difluoromethoxy)-3-fluorophenyl] 4-(4-methylcyclohexyl)benzoate;molecular hydrogen.
Molecular Properties
| Compound Name | [4-(difluoromethoxy)-3-fluorophenyl] 4-(4-methylcyclohexyl)benzoate;molecular hydrogen |
| PubChem CID | 157098918 |
| Molecular Formula | C21H23F3O3 |
| Molecular Weight | 380.41 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | [4-(difluoromethoxy)-3-fluorophenyl] 4-(4-methylcyclohexyl)benzoate;molecular hydrogen |
| SMILES | CC1CCC(c2ccc(C(=O)Oc3ccc(OC(F)F)c(F)c3)cc2)CC1.[H][H] |
| InChI | InChI=1S/C21H21F3O3.H2/c1-13-2-4-14(5-3-13)15-6-8-16(9-7-15)20(25)26-17-10-11-19(18(22)12-17)27-21(23)24;/h6-14,21H,2-5H2,1H3;1H |
| InChIKey | AFNNSKZHTFLWMH-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 380.41 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(difluoromethoxy)-3-fluorophenyl] 4-(4-methylcyclohexyl)benzoate;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(difluoromethoxy)-3-fluorophenyl] 4-(4-methylcyclohexyl)benzoate;molecular hydrogen?
The IUPAC name of [4-(difluoromethoxy)-3-fluorophenyl] 4-(4-methylcyclohexyl)benzoate;molecular hydrogen (CID 157098918) is [4-(difluoromethoxy)-3-fluorophenyl] 4-(4-methylcyclohexyl)benzoate;molecular hydrogen.
What is the SMILES notation for [4-(difluoromethoxy)-3-fluorophenyl] 4-(4-methylcyclohexyl)benzoate;molecular hydrogen?
The canonical SMILES for [4-(difluoromethoxy)-3-fluorophenyl] 4-(4-methylcyclohexyl)benzoate;molecular hydrogen is CC1CCC(c2ccc(C(=O)Oc3ccc(OC(F)F)c(F)c3)cc2)CC1.[H][H].
What is the InChIKey of [4-(difluoromethoxy)-3-fluorophenyl] 4-(4-methylcyclohexyl)benzoate;molecular hydrogen?
The InChIKey is AFNNSKZHTFLWMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21F3O3.H2/c1-13-2-4-14(5-3-13)15-6-8-16(9-7-15)20(25)26-17-10-11-19(18(22)12-17)27-21(23)24;/h6-14,21H,2-5H2,1H3;1H.
What are the key properties of [4-(difluoromethoxy)-3-fluorophenyl] 4-(4-methylcyclohexyl)benzoate;molecular hydrogen?
[4-(difluoromethoxy)-3-fluorophenyl] 4-(4-methylcyclohexyl)benzoate;molecular hydrogen has a molecular weight of 380.41 g/mol, XLogP of 6.19, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(difluoromethoxy)-3-fluorophenyl] 4-(4-methylcyclohexyl)benzoate;molecular hydrogen is sourced from PubChem (CID 157098918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).