C20H19F2O2Y+2 — CID 18720762
(3,5-difluorobenzene-4-id-1-yl) 4-(4-methylcyclohexyl)benzoate;yttrium(3+) (PubChem CID 18720762) has the molecular formula C20H19F2O2Y+2 and a molecular weight of 418.27 g/mol. Its IUPAC name is (3,5-difluorobenzene-4-id-1-yl) 4-(4-methylcyclohexyl)benzoate;yttrium(3+).
| Compound Name | (3,5-difluorobenzene-4-id-1-yl) 4-(4-methylcyclohexyl)benzoate;yttrium(3+) |
|---|---|
| PubChem CID | 18720762 |
| Molecular Formula | C20H19F2O2Y+2 |
| Molecular Weight | 418.27 g/mol |
| Exact Mass | 418.04 |
| IUPAC Name | (3,5-difluorobenzene-4-id-1-yl) 4-(4-methylcyclohexyl)benzoate;yttrium(3+) |
| SMILES | CC1CCC(c2ccc(C(=O)Oc3cc(F)[c-]c(F)c3)cc2)CC1.[Y+3] |
| InChI | InChI=1S/C20H19F2O2.Y/c1-13-2-4-14(5-3-13)15-6-8-16(9-7-15)20(23)24-19-11-17(21)10-18(22)12-19;/h6-9,11-14H,2-5H2,1H3;/q-1;+3 |
| InChIKey | WTHJNMAEEHZWPO-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.27 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|