C26H29F4OY+2 — CID 18720922
1-[difluoro-[4-[4-(4-methylcyclohexyl)cyclohexyl]phenyl]methoxy]-3,5-difluorobenzene-4-ide;yttrium(3+) (PubChem CID 18720922) has the molecular formula C26H29F4OY+2 and a molecular weight of 522.42 g/mol. Its IUPAC name is 1-[difluoro-[4-[4-(4-methylcyclohexyl)cyclohexyl]phenyl]methoxy]-3,5-difluorobenzene-4-ide;yttrium(3+).
| Compound Name | 1-[difluoro-[4-[4-(4-methylcyclohexyl)cyclohexyl]phenyl]methoxy]-3,5-difluorobenzene-4-ide;yttrium(3+) |
|---|---|
| PubChem CID | 18720922 |
| Molecular Formula | C26H29F4OY+2 |
| Molecular Weight | 522.42 g/mol |
| Exact Mass | 522.12 |
| IUPAC Name | 1-[difluoro-[4-[4-(4-methylcyclohexyl)cyclohexyl]phenyl]methoxy]-3,5-difluorobenzene-4-ide;yttrium(3+) |
| SMILES | CC1CCC(C2CCC(c3ccc(C(F)(F)Oc4cc(F)[c-]c(F)c4)cc3)CC2)CC1.[Y+3] |
| InChI | InChI=1S/C26H29F4O.Y/c1-17-2-4-18(5-3-17)19-6-8-20(9-7-19)21-10-12-22(13-11-21)26(29,30)31-25-15-23(27)14-24(28)16-25;/h10-13,15-20H,2-9H2,1H3;/q-1;+3 |
| InChIKey | LUAHWLUBRPJVNL-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.42 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|