C20H19F4OY+2 — CID 18720934
1-[difluoro-[4-(4-methylcyclohexyl)phenyl]methoxy]-3,5-difluorobenzene-4-ide;yttrium(3+) (PubChem CID 18720934) has the molecular formula C20H19F4OY+2 and a molecular weight of 440.27 g/mol. Its IUPAC name is 1-[difluoro-[4-(4-methylcyclohexyl)phenyl]methoxy]-3,5-difluorobenzene-4-ide;yttrium(3+).
| Compound Name | 1-[difluoro-[4-(4-methylcyclohexyl)phenyl]methoxy]-3,5-difluorobenzene-4-ide;yttrium(3+) |
|---|---|
| PubChem CID | 18720934 |
| Molecular Formula | C20H19F4OY+2 |
| Molecular Weight | 440.27 g/mol |
| Exact Mass | 440.04 |
| IUPAC Name | 1-[difluoro-[4-(4-methylcyclohexyl)phenyl]methoxy]-3,5-difluorobenzene-4-ide;yttrium(3+) |
| SMILES | CC1CCC(c2ccc(C(F)(F)Oc3cc(F)[c-]c(F)c3)cc2)CC1.[Y+3] |
| InChI | InChI=1S/C20H19F4O.Y/c1-13-2-4-14(5-3-13)15-6-8-16(9-7-15)20(23,24)25-19-11-17(21)10-18(22)12-19;/h6-9,11-14H,2-5H2,1H3;/q-1;+3 |
| InChIKey | GZZMXJGYSAKYRF-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.27 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|