About (5-methylpyrimidin-2-yl) 4-(4-methylcyclohexyl)benzoate
(5-methylpyrimidin-2-yl) 4-(4-methylcyclohexyl)benzoate (PubChem CID 21360257) has the molecular formula C19H22N2O2
and a molecular weight of 310.40 g/mol. Its IUPAC name is (5-methylpyrimidin-2-yl) 4-(4-methylcyclohexyl)benzoate.
Molecular Properties
| Compound Name | (5-methylpyrimidin-2-yl) 4-(4-methylcyclohexyl)benzoate |
| PubChem CID | 21360257 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | (5-methylpyrimidin-2-yl) 4-(4-methylcyclohexyl)benzoate |
| SMILES | Cc1cnc(OC(=O)c2ccc(C3CCC(C)CC3)cc2)nc1 |
| InChI | InChI=1S/C19H22N2O2/c1-13-3-5-15(6-4-13)16-7-9-17(10-8-16)18(22)23-19-20-11-14(2)12-21-19/h7-13,15H,3-6H2,1-2H3 |
| InChIKey | DDNUQFAVXAEKFD-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (5-methylpyrimidin-2-yl) 4-(4-methylcyclohexyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methylpyrimidin-2-yl) 4-(4-methylcyclohexyl)benzoate?
The IUPAC name of (5-methylpyrimidin-2-yl) 4-(4-methylcyclohexyl)benzoate (CID 21360257) is (5-methylpyrimidin-2-yl) 4-(4-methylcyclohexyl)benzoate.
What is the SMILES notation for (5-methylpyrimidin-2-yl) 4-(4-methylcyclohexyl)benzoate?
The canonical SMILES for (5-methylpyrimidin-2-yl) 4-(4-methylcyclohexyl)benzoate is Cc1cnc(OC(=O)c2ccc(C3CCC(C)CC3)cc2)nc1.
What is the InChIKey of (5-methylpyrimidin-2-yl) 4-(4-methylcyclohexyl)benzoate?
The InChIKey is DDNUQFAVXAEKFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N2O2/c1-13-3-5-15(6-4-13)16-7-9-17(10-8-16)18(22)23-19-20-11-14(2)12-21-19/h7-13,15H,3-6H2,1-2H3.
What are the key properties of (5-methylpyrimidin-2-yl) 4-(4-methylcyclohexyl)benzoate?
(5-methylpyrimidin-2-yl) 4-(4-methylcyclohexyl)benzoate has a molecular weight of 310.40 g/mol, XLogP of 4.30, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methylpyrimidin-2-yl) 4-(4-methylcyclohexyl)benzoate is sourced from PubChem (CID 21360257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).