(5-methylpyrimidin-2-yl) 4-(4-methylcyclohexyl)benzoate

C19H22N2O2 — CID 21360257

IUPAC(5-methylpyrimidin-2-yl) 4-(4-methylcyclohexyl)benzoate
SMILESCc1cnc(OC(=O)c2ccc(C3CCC(C)CC3)cc2)nc1
InChIInChI=1S/C19H22N2O2/c1-13-3-5-15(6-4-13)16-7-9-17(10-8-16)18(22)23-19-20-11-14(2)12-21-19/h7-13,15H,3-6H2,1-2H3
InChIKeyDDNUQFAVXAEKFD-UHFFFAOYSA-N
MW310.40 g/mol
LogP4.30
Rot. Bonds3

About (5-methylpyrimidin-2-yl) 4-(4-methylcyclohexyl)benzoate

(5-methylpyrimidin-2-yl) 4-(4-methylcyclohexyl)benzoate (PubChem CID 21360257) has the molecular formula C19H22N2O2 and a molecular weight of 310.40 g/mol. Its IUPAC name is (5-methylpyrimidin-2-yl) 4-(4-methylcyclohexyl)benzoate.

Molecular Properties

Compound Name(5-methylpyrimidin-2-yl) 4-(4-methylcyclohexyl)benzoate
PubChem CID21360257
Molecular FormulaC19H22N2O2
Molecular Weight310.40 g/mol
Exact Mass310.17
IUPAC Name(5-methylpyrimidin-2-yl) 4-(4-methylcyclohexyl)benzoate
SMILESCc1cnc(OC(=O)c2ccc(C3CCC(C)CC3)cc2)nc1
InChIInChI=1S/C19H22N2O2/c1-13-3-5-15(6-4-13)16-7-9-17(10-8-16)18(22)23-19-20-11-14(2)12-21-19/h7-13,15H,3-6H2,1-2H3
InChIKeyDDNUQFAVXAEKFD-UHFFFAOYSA-N
XLogP4.30
TPSA52.08 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500310.40
LogP ≤ 54.30
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze (5-methylpyrimidin-2-yl) 4-(4-methylcyclohexyl)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (5-methylpyrimidin-2-yl) 4-(4-methylcyclohexyl)benzoate?
The IUPAC name of (5-methylpyrimidin-2-yl) 4-(4-methylcyclohexyl)benzoate (CID 21360257) is (5-methylpyrimidin-2-yl) 4-(4-methylcyclohexyl)benzoate.
What is the SMILES notation for (5-methylpyrimidin-2-yl) 4-(4-methylcyclohexyl)benzoate?
The canonical SMILES for (5-methylpyrimidin-2-yl) 4-(4-methylcyclohexyl)benzoate is Cc1cnc(OC(=O)c2ccc(C3CCC(C)CC3)cc2)nc1.
What is the InChIKey of (5-methylpyrimidin-2-yl) 4-(4-methylcyclohexyl)benzoate?
The InChIKey is DDNUQFAVXAEKFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N2O2/c1-13-3-5-15(6-4-13)16-7-9-17(10-8-16)18(22)23-19-20-11-14(2)12-21-19/h7-13,15H,3-6H2,1-2H3.
What are the key properties of (5-methylpyrimidin-2-yl) 4-(4-methylcyclohexyl)benzoate?
(5-methylpyrimidin-2-yl) 4-(4-methylcyclohexyl)benzoate has a molecular weight of 310.40 g/mol, XLogP of 4.30, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methylpyrimidin-2-yl) 4-(4-methylcyclohexyl)benzoate is sourced from PubChem (CID 21360257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).