C21H21NO2 — CID 20640863
(4-cyanophenyl) 4-(4-methylcyclohexyl)benzoate (PubChem CID 20640863) has the molecular formula C21H21NO2 and a molecular weight of 319.40 g/mol. Its IUPAC name is (4-cyanophenyl) 4-(4-methylcyclohexyl)benzoate.
| Compound Name | (4-cyanophenyl) 4-(4-methylcyclohexyl)benzoate |
|---|---|
| PubChem CID | 20640863 |
| Molecular Formula | C21H21NO2 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | (4-cyanophenyl) 4-(4-methylcyclohexyl)benzoate |
| SMILES | CC1CCC(c2ccc(C(=O)Oc3ccc(C#N)cc3)cc2)CC1 |
| InChI | InChI=1S/C21H21NO2/c1-15-2-6-17(7-3-15)18-8-10-19(11-9-18)21(23)24-20-12-4-16(14-22)5-13-20/h4-5,8-13,15,17H,2-3,6-7H2,1H3 |
| InChIKey | ZXHPLHCVJRLAEN-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|