C14H17N — CID 18464047
4-(4-methylcyclohexyl)benzonitrile (PubChem CID 18464047) has the molecular formula C14H17N and a molecular weight of 199.30 g/mol. Its IUPAC name is 4-(4-methylcyclohexyl)benzonitrile.
| Compound Name | 4-(4-methylcyclohexyl)benzonitrile |
|---|---|
| PubChem CID | 18464047 |
| Molecular Formula | C14H17N |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | 4-(4-methylcyclohexyl)benzonitrile |
| SMILES | CC1CCC(c2ccc(C#N)cc2)CC1 |
| InChI | InChI=1S/C14H17N/c1-11-2-6-13(7-3-11)14-8-4-12(10-15)5-9-14/h4-5,8-9,11,13H,2-3,6-7H2,1H3 |
| InChIKey | USJAJMMCQIBKSR-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |