C20H19I2N — CID 130443697
2,6-diiodo-4-[4-(4-methylcyclohexyl)phenyl]benzonitrile (PubChem CID 130443697) has the molecular formula C20H19I2N and a molecular weight of 527.19 g/mol. Its IUPAC name is 2,6-diiodo-4-[4-(4-methylcyclohexyl)phenyl]benzonitrile.
| Compound Name | 2,6-diiodo-4-[4-(4-methylcyclohexyl)phenyl]benzonitrile |
|---|---|
| PubChem CID | 130443697 |
| Molecular Formula | C20H19I2N |
| Molecular Weight | 527.19 g/mol |
| Exact Mass | 526.96 |
| IUPAC Name | 2,6-diiodo-4-[4-(4-methylcyclohexyl)phenyl]benzonitrile |
| SMILES | CC1CCC(c2ccc(-c3cc(I)c(C#N)c(I)c3)cc2)CC1 |
| InChI | InChI=1S/C20H19I2N/c1-13-2-4-14(5-3-13)15-6-8-16(9-7-15)17-10-19(21)18(12-23)20(22)11-17/h6-11,13-14H,2-5H2,1H3 |
| InChIKey | LLNCGKJBUVUUCF-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.19 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|