C23H24FN — CID 163272794
4-[4-(4-cyclopropylcyclohexyl)phenyl]-2-fluoro-6-methylbenzonitrile (PubChem CID 163272794) has the molecular formula C23H24FN and a molecular weight of 333.45 g/mol. Its IUPAC name is 4-[4-(4-cyclopropylcyclohexyl)phenyl]-2-fluoro-6-methylbenzonitrile.
| Compound Name | 4-[4-(4-cyclopropylcyclohexyl)phenyl]-2-fluoro-6-methylbenzonitrile |
|---|---|
| PubChem CID | 163272794 |
| Molecular Formula | C23H24FN |
| Molecular Weight | 333.45 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | 4-[4-(4-cyclopropylcyclohexyl)phenyl]-2-fluoro-6-methylbenzonitrile |
| SMILES | Cc1cc(-c2ccc(C3CCC(C4CC4)CC3)cc2)cc(F)c1C#N |
| InChI | InChI=1S/C23H24FN/c1-15-12-21(13-23(24)22(15)14-25)20-10-8-19(9-11-20)18-6-4-17(5-7-18)16-2-3-16/h8-13,16-18H,2-7H2,1H3 |
| InChIKey | GTHPQFYXXBQHMI-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.45 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |