C57H70F8 — CID 144841355
1,2-difluoro-4-[4-(4-methylcyclohexyl)cyclohexyl]benzene;1,2,3-trifluoro-5-[4-(4-methylcyclohexyl)cyclohexyl]benzene;1,2,3-trifluoro-5-[4-(4-methylcyclohexyl)phenyl]benzene (PubChem CID 144841355) has the molecular formula C57H70F8 and a molecular weight of 907.17 g/mol. Its IUPAC name is 1,2-difluoro-4-[4-(4-methylcyclohexyl)cyclohexyl]benzene;1,2,3-trifluoro-5-[4-(4-methylcyclohexyl)cyclohexyl]benzene;1,2,3-trifluoro-5-[4-(4-methylcyclohexyl)phenyl]benzene.
| Compound Name | 1,2-difluoro-4-[4-(4-methylcyclohexyl)cyclohexyl]benzene;1,2,3-trifluoro-5-[4-(4-methylcyclohexyl)cyclohexyl]benzene;1,2,3-trifluoro-5-[4-(4-methylcyclohexyl)phenyl]benzene |
|---|---|
| PubChem CID | 144841355 |
| Molecular Formula | C57H70F8 |
| Molecular Weight | 907.17 g/mol |
| Exact Mass | 906.53 |
| IUPAC Name | 1,2-difluoro-4-[4-(4-methylcyclohexyl)cyclohexyl]benzene;1,2,3-trifluoro-5-[4-(4-methylcyclohexyl)cyclohexyl]benzene;1,2,3-trifluoro-5-[4-(4-methylcyclohexyl)phenyl]benzene |
| SMILES | CC1CCC(C2CCC(c3cc(F)c(F)c(F)c3)CC2)CC1.CC1CCC(C2CCC(c3ccc(F)c(F)c3)CC2)CC1.CC1CCC(c2ccc(-c3cc(F)c(F)c(F)c3)cc2)CC1 |
| InChI | InChI=1S/C19H25F3.C19H19F3.C19H26F2/c2*1-12-2-4-13(5-3-12)14-6-8-15(9-7-14)16-10-17(20)19(22)18(21)11-16;1-13-2-4-14(5-3-13)15-6-8-16(9-7-15)17-10-11-18(20)19(21)12-17/h10-15H,2-9H2,1H3;6-13H,2-5H2,1H3;10-16H,2-9H2,1H3 |
| InChIKey | IFVBTWZCDUYGQY-UHFFFAOYSA-N |
| XLogP | 18.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 907.17 |
| LogP ≤ 5 | 18.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|