C27H32F2 — CID 134236125
5-[4-[4-(4-ethenylcyclohexyl)cyclohexyl]phenyl]-1,3-difluoro-2-methylbenzene (PubChem CID 134236125) has the molecular formula C27H32F2 and a molecular weight of 394.55 g/mol. Its IUPAC name is 5-[4-[4-(4-ethenylcyclohexyl)cyclohexyl]phenyl]-1,3-difluoro-2-methylbenzene.
| Compound Name | 5-[4-[4-(4-ethenylcyclohexyl)cyclohexyl]phenyl]-1,3-difluoro-2-methylbenzene |
|---|---|
| PubChem CID | 134236125 |
| Molecular Formula | C27H32F2 |
| Molecular Weight | 394.55 g/mol |
| Exact Mass | 394.25 |
| IUPAC Name | 5-[4-[4-(4-ethenylcyclohexyl)cyclohexyl]phenyl]-1,3-difluoro-2-methylbenzene |
| SMILES | C=CC1CCC(C2CCC(c3ccc(-c4cc(F)c(C)c(F)c4)cc3)CC2)CC1 |
| InChI | InChI=1S/C27H32F2/c1-3-19-4-6-20(7-5-19)21-8-10-22(11-9-21)23-12-14-24(15-13-23)25-16-26(28)18(2)27(29)17-25/h3,12-17,19-22H,1,4-11H2,2H3 |
| InChIKey | DRLRKFDVWYFTSH-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.55 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|