C20H27F — CID 19380515
1-[4-(4-ethenylcyclohexyl)cyclohexyl]-4-fluorobenzene (PubChem CID 19380515) has the molecular formula C20H27F and a molecular weight of 286.43 g/mol. Its IUPAC name is 1-[4-(4-ethenylcyclohexyl)cyclohexyl]-4-fluorobenzene.
| Compound Name | 1-[4-(4-ethenylcyclohexyl)cyclohexyl]-4-fluorobenzene |
|---|---|
| PubChem CID | 19380515 |
| Molecular Formula | C20H27F |
| Molecular Weight | 286.43 g/mol |
| Exact Mass | 286.21 |
| IUPAC Name | 1-[4-(4-ethenylcyclohexyl)cyclohexyl]-4-fluorobenzene |
| SMILES | C=CC1CCC(C2CCC(c3ccc(F)cc3)CC2)CC1 |
| InChI | InChI=1S/C20H27F/c1-2-15-3-5-16(6-4-15)17-7-9-18(10-8-17)19-11-13-20(21)14-12-19/h2,11-18H,1,3-10H2 |
| InChIKey | KTFHANHVOKLNOH-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.43 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|