C20H35F — CID 160545349
1-fluoro-4-[4-(4-methylcyclohexyl)cyclohexyl]benzene;methane;molecular hydrogen (PubChem CID 160545349) has the molecular formula C20H35F and a molecular weight of 294.50 g/mol. Its IUPAC name is 1-fluoro-4-[4-(4-methylcyclohexyl)cyclohexyl]benzene;methane;molecular hydrogen.
| Compound Name | 1-fluoro-4-[4-(4-methylcyclohexyl)cyclohexyl]benzene;methane;molecular hydrogen |
|---|---|
| PubChem CID | 160545349 |
| Molecular Formula | C20H35F |
| Molecular Weight | 294.50 g/mol |
| Exact Mass | 294.27 |
| IUPAC Name | 1-fluoro-4-[4-(4-methylcyclohexyl)cyclohexyl]benzene;methane;molecular hydrogen |
| SMILES | C.CC1CCC(C2CCC(c3ccc(F)cc3)CC2)CC1.[H][H].[H][H] |
| InChI | InChI=1S/C19H27F.CH4.2H2/c1-14-2-4-15(5-3-14)16-6-8-17(9-7-16)18-10-12-19(20)13-11-18;;;/h10-17H,2-9H2,1H3;1H4;2*1H |
| InChIKey | QXIUSTFQVOLSIP-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.50 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |