1-fluoro-4-(4-methylcyclohexyl)benzene;molecular hydrogen

C13H19F — CID 158127728

IUPAC1-fluoro-4-(4-methylcyclohexyl)benzene;molecular hydrogen
SMILESCC1CCC(c2ccc(F)cc2)CC1.[H][H]
InChIInChI=1S/C13H17F.H2/c1-10-2-4-11(5-3-10)12-6-8-13(14)9-7-12;/h6-11H,2-5H2,1H3;1H
InChIKeyFSJUPZPAVQCGER-UHFFFAOYSA-N
MW194.29 g/mol
LogP4.37
Rot. Bonds1

About 1-fluoro-4-(4-methylcyclohexyl)benzene;molecular hydrogen

1-fluoro-4-(4-methylcyclohexyl)benzene;molecular hydrogen (PubChem CID 158127728) has the molecular formula C13H19F and a molecular weight of 194.29 g/mol. Its IUPAC name is 1-fluoro-4-(4-methylcyclohexyl)benzene;molecular hydrogen.

Molecular Properties

Compound Name1-fluoro-4-(4-methylcyclohexyl)benzene;molecular hydrogen
PubChem CID158127728
Molecular FormulaC13H19F
Molecular Weight194.29 g/mol
Exact Mass194.15
IUPAC Name1-fluoro-4-(4-methylcyclohexyl)benzene;molecular hydrogen
SMILESCC1CCC(c2ccc(F)cc2)CC1.[H][H]
InChIInChI=1S/C13H17F.H2/c1-10-2-4-11(5-3-10)12-6-8-13(14)9-7-12;/h6-11H,2-5H2,1H3;1H
InChIKeyFSJUPZPAVQCGER-UHFFFAOYSA-N
XLogP4.37
TPSA0.00 Ų
H-Bond Donors
H-Bond Acceptors
Rotatable Bonds1
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500194.29
LogP ≤ 54.37
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 100

Analyze 1-fluoro-4-(4-methylcyclohexyl)benzene;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-fluoro-4-(4-methylcyclohexyl)benzene;molecular hydrogen?
The IUPAC name of 1-fluoro-4-(4-methylcyclohexyl)benzene;molecular hydrogen (CID 158127728) is 1-fluoro-4-(4-methylcyclohexyl)benzene;molecular hydrogen.
What is the SMILES notation for 1-fluoro-4-(4-methylcyclohexyl)benzene;molecular hydrogen?
The canonical SMILES for 1-fluoro-4-(4-methylcyclohexyl)benzene;molecular hydrogen is CC1CCC(c2ccc(F)cc2)CC1.[H][H].
What is the InChIKey of 1-fluoro-4-(4-methylcyclohexyl)benzene;molecular hydrogen?
The InChIKey is FSJUPZPAVQCGER-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17F.H2/c1-10-2-4-11(5-3-10)12-6-8-13(14)9-7-12;/h6-11H,2-5H2,1H3;1H.
What are the key properties of 1-fluoro-4-(4-methylcyclohexyl)benzene;molecular hydrogen?
1-fluoro-4-(4-methylcyclohexyl)benzene;molecular hydrogen has a molecular weight of 194.29 g/mol, XLogP of 4.37, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoro-4-(4-methylcyclohexyl)benzene;molecular hydrogen is sourced from PubChem (CID 158127728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).