About ethane;4-(4-fluorophenyl)cyclohexan-1-one;molecular hydrogen
ethane;4-(4-fluorophenyl)cyclohexan-1-one;molecular hydrogen (PubChem CID 142101023) has the molecular formula C14H21FO
and a molecular weight of 224.32 g/mol. Its IUPAC name is ethane;4-(4-fluorophenyl)cyclohexan-1-one;molecular hydrogen.
Molecular Properties
| Compound Name | ethane;4-(4-fluorophenyl)cyclohexan-1-one;molecular hydrogen |
| PubChem CID | 142101023 |
| Molecular Formula | C14H21FO |
| Molecular Weight | 224.32 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | ethane;4-(4-fluorophenyl)cyclohexan-1-one;molecular hydrogen |
| SMILES | CC.O=C1CCC(c2ccc(F)cc2)CC1.[H][H] |
| InChI | InChI=1S/C12H13FO.C2H6.H2/c13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10;1-2;/h1-2,5-6,10H,3-4,7-8H2;1-2H3;1H |
| InChIKey | NMLRMZONXCIYPM-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.32 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;4-(4-fluorophenyl)cyclohexan-1-one;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-(4-fluorophenyl)cyclohexan-1-one;molecular hydrogen?
The IUPAC name of ethane;4-(4-fluorophenyl)cyclohexan-1-one;molecular hydrogen (CID 142101023) is ethane;4-(4-fluorophenyl)cyclohexan-1-one;molecular hydrogen.
What is the SMILES notation for ethane;4-(4-fluorophenyl)cyclohexan-1-one;molecular hydrogen?
The canonical SMILES for ethane;4-(4-fluorophenyl)cyclohexan-1-one;molecular hydrogen is CC.O=C1CCC(c2ccc(F)cc2)CC1.[H][H].
What is the InChIKey of ethane;4-(4-fluorophenyl)cyclohexan-1-one;molecular hydrogen?
The InChIKey is NMLRMZONXCIYPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13FO.C2H6.H2/c13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10;1-2;/h1-2,5-6,10H,3-4,7-8H2;1-2H3;1H.
What are the key properties of ethane;4-(4-fluorophenyl)cyclohexan-1-one;molecular hydrogen?
ethane;4-(4-fluorophenyl)cyclohexan-1-one;molecular hydrogen has a molecular weight of 224.32 g/mol, XLogP of 4.32, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-(4-fluorophenyl)cyclohexan-1-one;molecular hydrogen is sourced from PubChem (CID 142101023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).