About ethane;methanol;4-phenylcyclohexan-1-one
ethane;methanol;4-phenylcyclohexan-1-one (PubChem CID 91076562) has the molecular formula C15H24O2
and a molecular weight of 236.36 g/mol. Its IUPAC name is ethane;methanol;4-phenylcyclohexan-1-one.
Molecular Properties
| Compound Name | ethane;methanol;4-phenylcyclohexan-1-one |
| PubChem CID | 91076562 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | ethane;methanol;4-phenylcyclohexan-1-one |
| SMILES | CC.CO.O=C1CCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C12H14O.C2H6.CH4O/c13-12-8-6-11(7-9-12)10-4-2-1-3-5-10;2*1-2/h1-5,11H,6-9H2;1-2H3;2H,1H3 |
| InChIKey | AUXLHCPBKBMVAT-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;methanol;4-phenylcyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methanol;4-phenylcyclohexan-1-one?
The IUPAC name of ethane;methanol;4-phenylcyclohexan-1-one (CID 91076562) is ethane;methanol;4-phenylcyclohexan-1-one.
What is the SMILES notation for ethane;methanol;4-phenylcyclohexan-1-one?
The canonical SMILES for ethane;methanol;4-phenylcyclohexan-1-one is CC.CO.O=C1CCC(c2ccccc2)CC1.
What is the InChIKey of ethane;methanol;4-phenylcyclohexan-1-one?
The InChIKey is AUXLHCPBKBMVAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O.C2H6.CH4O/c13-12-8-6-11(7-9-12)10-4-2-1-3-5-10;2*1-2/h1-5,11H,6-9H2;1-2H3;2H,1H3.
What are the key properties of ethane;methanol;4-phenylcyclohexan-1-one?
ethane;methanol;4-phenylcyclohexan-1-one has a molecular weight of 236.36 g/mol, XLogP of 3.55, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methanol;4-phenylcyclohexan-1-one is sourced from PubChem (CID 91076562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).