C19H20O — CID 58293688
trans-(4R,5R)-4,5-diphenylcycloheptan-1-one (PubChem CID 58293688) has the molecular formula C19H20O and a molecular weight of 264.37 g/mol. Its IUPAC name is trans-(4R,5R)-4,5-diphenylcycloheptan-1-one.
| Compound Name | trans-(4R,5R)-4,5-diphenylcycloheptan-1-one |
|---|---|
| PubChem CID | 58293688 |
| Molecular Formula | C19H20O |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | trans-(4R,5R)-4,5-diphenylcycloheptan-1-one |
| SMILES | O=C1CC[C@@H](c2ccccc2)[C@H](c2ccccc2)CC1 |
| InChI | InChI=1S/C19H20O/c20-17-11-13-18(15-7-3-1-4-8-15)19(14-12-17)16-9-5-2-6-10-16/h1-10,18-19H,11-14H2/t18-,19-/m0/s1 |
| InChIKey | IWUJPYIFYYGCOL-OALUTQOASA-N |
| XLogP | 4.70 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |