C18H19NO — CID 76744086
N-(3,4-diphenylcyclohexylidene)hydroxylamine (PubChem CID 76744086) has the molecular formula C18H19NO and a molecular weight of 265.36 g/mol. Its IUPAC name is N-(3,4-diphenylcyclohexylidene)hydroxylamine.
| Compound Name | N-(3,4-diphenylcyclohexylidene)hydroxylamine |
|---|---|
| PubChem CID | 76744086 |
| Molecular Formula | C18H19NO |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | N-(3,4-diphenylcyclohexylidene)hydroxylamine |
| SMILES | ON=C1CCC(c2ccccc2)C(c2ccccc2)C1 |
| InChI | InChI=1S/C18H19NO/c20-19-16-11-12-17(14-7-3-1-4-8-14)18(13-16)15-9-5-2-6-10-15/h1-10,17-18,20H,11-13H2 |
| InChIKey | FLAREEUHPXSCHB-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|