C23H32O — CID 123156806
3,4-diphenylcycloheptan-1-one;ethane (PubChem CID 123156806) has the molecular formula C23H32O and a molecular weight of 324.51 g/mol. Its IUPAC name is 3,4-diphenylcycloheptan-1-one;ethane.
| Compound Name | 3,4-diphenylcycloheptan-1-one;ethane |
|---|---|
| PubChem CID | 123156806 |
| Molecular Formula | C23H32O |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.25 |
| IUPAC Name | 3,4-diphenylcycloheptan-1-one;ethane |
| SMILES | CC.CC.O=C1CCCC(c2ccccc2)C(c2ccccc2)C1 |
| InChI | InChI=1S/C19H20O.2C2H6/c20-17-12-7-13-18(15-8-3-1-4-9-15)19(14-17)16-10-5-2-6-11-16;2*1-2/h1-6,8-11,18-19H,7,12-14H2;2*1-2H3 |
| InChIKey | ABRTYXRKZNOZJE-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |