About trans-(3S,4R)-3-phenyl-4-propan-2-ylcyclopentan-1-one
trans-(3S,4R)-3-phenyl-4-propan-2-ylcyclopentan-1-one (PubChem CID 100973232) has the molecular formula C14H18O
and a molecular weight of 202.30 g/mol. Its IUPAC name is trans-(3S,4R)-3-phenyl-4-propan-2-ylcyclopentan-1-one.
Molecular Properties
| Compound Name | trans-(3S,4R)-3-phenyl-4-propan-2-ylcyclopentan-1-one |
| PubChem CID | 100973232 |
| Molecular Formula | C14H18O |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | trans-(3S,4R)-3-phenyl-4-propan-2-ylcyclopentan-1-one |
| SMILES | CC(C)[C@H]1CC(=O)C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C14H18O/c1-10(2)13-8-12(15)9-14(13)11-6-4-3-5-7-11/h3-7,10,13-14H,8-9H2,1-2H3/t13-,14-/m1/s1 |
| InChIKey | QZWIOGAKYPWURK-ZIAGYGMSSA-N |
| XLogP | 3.41 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze trans-(3S,4R)-3-phenyl-4-propan-2-ylcyclopentan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(3S,4R)-3-phenyl-4-propan-2-ylcyclopentan-1-one?
The IUPAC name of trans-(3S,4R)-3-phenyl-4-propan-2-ylcyclopentan-1-one (CID 100973232) is trans-(3S,4R)-3-phenyl-4-propan-2-ylcyclopentan-1-one.
What is the SMILES notation for trans-(3S,4R)-3-phenyl-4-propan-2-ylcyclopentan-1-one?
The canonical SMILES for trans-(3S,4R)-3-phenyl-4-propan-2-ylcyclopentan-1-one is CC(C)[C@H]1CC(=O)C[C@@H]1c1ccccc1.
What is the InChIKey of trans-(3S,4R)-3-phenyl-4-propan-2-ylcyclopentan-1-one?
The InChIKey is QZWIOGAKYPWURK-ZIAGYGMSSA-N. The full InChI is InChI=1S/C14H18O/c1-10(2)13-8-12(15)9-14(13)11-6-4-3-5-7-11/h3-7,10,13-14H,8-9H2,1-2H3/t13-,14-/m1/s1.
What are the key properties of trans-(3S,4R)-3-phenyl-4-propan-2-ylcyclopentan-1-one?
trans-(3S,4R)-3-phenyl-4-propan-2-ylcyclopentan-1-one has a molecular weight of 202.30 g/mol, XLogP of 3.41, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(3S,4R)-3-phenyl-4-propan-2-ylcyclopentan-1-one is sourced from PubChem (CID 100973232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).