About cis-(4S,5R)-4-methyl-5-phenylcyclohexane-1,3-dione
cis-(4S,5R)-4-methyl-5-phenylcyclohexane-1,3-dione (PubChem CID 59919081) has the molecular formula C13H14O2
and a molecular weight of 202.25 g/mol. Its IUPAC name is cis-(4S,5R)-4-methyl-5-phenylcyclohexane-1,3-dione.
Molecular Properties
| Compound Name | cis-(4S,5R)-4-methyl-5-phenylcyclohexane-1,3-dione |
| PubChem CID | 59919081 |
| Molecular Formula | C13H14O2 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | cis-(4S,5R)-4-methyl-5-phenylcyclohexane-1,3-dione |
| SMILES | C[C@@H]1C(=O)CC(=O)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C13H14O2/c1-9-12(7-11(14)8-13(9)15)10-5-3-2-4-6-10/h2-6,9,12H,7-8H2,1H3/t9-,12+/m0/s1 |
| InChIKey | UXVWBPUNDZEIOG-JOYOIKCWSA-N |
| XLogP | 2.34 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze cis-(4S,5R)-4-methyl-5-phenylcyclohexane-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(4S,5R)-4-methyl-5-phenylcyclohexane-1,3-dione?
The IUPAC name of cis-(4S,5R)-4-methyl-5-phenylcyclohexane-1,3-dione (CID 59919081) is cis-(4S,5R)-4-methyl-5-phenylcyclohexane-1,3-dione.
What is the SMILES notation for cis-(4S,5R)-4-methyl-5-phenylcyclohexane-1,3-dione?
The canonical SMILES for cis-(4S,5R)-4-methyl-5-phenylcyclohexane-1,3-dione is C[C@@H]1C(=O)CC(=O)C[C@H]1c1ccccc1.
What is the InChIKey of cis-(4S,5R)-4-methyl-5-phenylcyclohexane-1,3-dione?
The InChIKey is UXVWBPUNDZEIOG-JOYOIKCWSA-N. The full InChI is InChI=1S/C13H14O2/c1-9-12(7-11(14)8-13(9)15)10-5-3-2-4-6-10/h2-6,9,12H,7-8H2,1H3/t9-,12+/m0/s1.
What are the key properties of cis-(4S,5R)-4-methyl-5-phenylcyclohexane-1,3-dione?
cis-(4S,5R)-4-methyl-5-phenylcyclohexane-1,3-dione has a molecular weight of 202.25 g/mol, XLogP of 2.34, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(4S,5R)-4-methyl-5-phenylcyclohexane-1,3-dione is sourced from PubChem (CID 59919081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).