C22H33N — CID 123989610
(3R,4R)-3,4-diphenylazepane;ethane (PubChem CID 123989610) has the molecular formula C22H33N and a molecular weight of 311.51 g/mol. Its IUPAC name is (3R,4R)-3,4-diphenylazepane;ethane.
| Compound Name | (3R,4R)-3,4-diphenylazepane;ethane |
|---|---|
| PubChem CID | 123989610 |
| Molecular Formula | C22H33N |
| Molecular Weight | 311.51 g/mol |
| Exact Mass | 311.26 |
| IUPAC Name | (3R,4R)-3,4-diphenylazepane;ethane |
| SMILES | CC.CC.c1ccc([C@@H]2CCCNC[C@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C18H21N.2C2H6/c1-3-8-15(9-4-1)17-12-7-13-19-14-18(17)16-10-5-2-6-11-16;2*1-2/h1-6,8-11,17-19H,7,12-14H2;2*1-2H3/t17-,18-;;/m0../s1 |
| InChIKey | GFGIJGXORVDGPO-MPGISEFESA-N |
| XLogP | 5.99 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.51 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |